CAS 1787916-50-0 appears in our catalog under these names: 1-(2,2-Difluoroethyl)-4-iodo-1H-pyrazole-5-carboxylic acid, 98%, 1-(2,2-Difluoroethyl)-4-iodo-1H-pyrazole-5-carboxylic acid, 1-(2,2-Difluoroethyl)-4-iodo-1H-pyrazole-5-carboxylic acid, 98%, 98%. Offered by: AmBeed, Biosynth, Chemat, Fluorochem. Available pack sizes: 10g, 1g, 100mg, 250mg, 5g.
1-(2,2-difluoroethyl)-4-iodopyrazole-5-carboxylic acid (CAS 1787916-50-0) is a chemical compound with the molecular formula C6H5F2IN2O2 and a molecular weight of 302.02 g/mol. IUPAC name: 1-(2,2-difluoroethyl)-4-iodopyrazole-5-carboxylic acid. InChIKey: AWQLFQRJACUBJD-UHFFFAOYSA-N.
| Molecular formula | C6H5F2IN2O2 |
|---|---|
| Molecular weight | 302.02 g/mol |
| IUPAC name | 1-(2,2-difluoroethyl)-4-iodopyrazole-5-carboxylic acid |
| InChIKey | AWQLFQRJACUBJD-UHFFFAOYSA-N |
| SMILES | C1=NN(C(=C1I)C(=O)O)CC(F)F |
Computed by PubChem (NCBI)