cas: 304858-45-5 — see every product listed under this CAS number, including other names
1-(2,4-DIMETHOXYBENZYL)-5-OXO-3-PYRROLIDINECARBOXYLIC ACID (CAS 304858-45-5) is a chemical reagent available from Chemat. Available pack sizes: 1g, 5g, 10g, 25g. Offered by: Fluorochem.
| brand | Fluorochem |
|---|---|
| catalog number | F502319-1G |
| cas | 304858-45-5 |
| size | 1g |
| brand | size | price | |
|---|---|---|---|
| Fluorochem | 1g | 159.34 Pln | |
| Fluorochem | 5g | 393.63 Pln | |
| Fluorochem | 10g | 700.81 Pln | |
| Fluorochem | 25g | 1559.89 Pln |
| delivery time | 3-4 weeks |
|---|
1-[(2,4-dimethoxyphenyl)methyl]-5-oxopyrrolidine-3-carboxylic acid (CAS 304858-45-5) is a chemical compound with the molecular formula C14H17NO5 and a molecular weight of 279.29 g/mol. IUPAC name: 1-[(2,4-dimethoxyphenyl)methyl]-5-oxopyrrolidine-3-carboxylic acid. InChIKey: OZFGRQLUQFPWPR-UHFFFAOYSA-N.
| Molecular formula | C14H17NO5 |
|---|---|
| Molecular weight | 279.29 g/mol |
| IUPAC name | 1-[(2,4-dimethoxyphenyl)methyl]-5-oxopyrrolidine-3-carboxylic acid |
| InChIKey | OZFGRQLUQFPWPR-UHFFFAOYSA-N |
| SMILES | COC1=CC(=C(C=C1)CN2CC(CC2=O)C(=O)O)OC |
Computed by PubChem (NCBI)