cas: 304858-45-5 — see every product listed under this CAS number, including other names
1-(2,4-Dimethoxybenzyl)-5-oxopyrrolidine-3-carboxylic acid, 95%+, 95%+ (CAS 304858-45-5) is a chemical reagent available from Chemat. Available pack sizes: 1g, 5g, 10g, 25g. Offered by: Chemat.
| brand | Chemat |
|---|---|
| catalog number | Ch1141AU-1g |
| cas | 304858-45-5 |
| size | 1g |
| availability | 50g |
| brand | size | price | |
|---|---|---|---|
| Chemat | 1g | 112.40 Pln | |
| Chemat | 5g | 256.40 Pln | |
| Chemat | 10g | 438.80 Pln | |
| Chemat | 25g | 957.20 Pln |
| purity | 95%+ |
|---|---|
| delivery time | 3 weeks |
1-[(2,4-dimethoxyphenyl)methyl]-5-oxopyrrolidine-3-carboxylic acid (CAS 304858-45-5) is a chemical compound with the molecular formula C14H17NO5 and a molecular weight of 279.29 g/mol. IUPAC name: 1-[(2,4-dimethoxyphenyl)methyl]-5-oxopyrrolidine-3-carboxylic acid. InChIKey: OZFGRQLUQFPWPR-UHFFFAOYSA-N.
| Molecular formula | C14H17NO5 |
|---|---|
| Molecular weight | 279.29 g/mol |
| IUPAC name | 1-[(2,4-dimethoxyphenyl)methyl]-5-oxopyrrolidine-3-carboxylic acid |
| InChIKey | OZFGRQLUQFPWPR-UHFFFAOYSA-N |
| SMILES | COC1=CC(=C(C=C1)CN2CC(CC2=O)C(=O)O)OC |
Computed by PubChem (NCBI)