cas: 887267-36-9 — see every product listed under this CAS number, including other names
1-(2,4-Dichloro-5-fluoro-3-nitrophenyl)ethanone, 97%, 97% (CAS 887267-36-9) is a chemical reagent available from Chemat. Available pack sizes: 100mg, 250mg, 1g, 5g. Offered by: Chemat.
| brand | Chemat |
|---|---|
| catalog number | Ch115705-100mg |
| cas | 887267-36-9 |
| size | 100mg |
| availability | 10g |
| brand | size | price | |
|---|---|---|---|
| Chemat | 100mg | 150.80 Pln | |
| Chemat | 250mg | 227.60 Pln | |
| Chemat | 1g | 491.60 Pln | |
| Chemat | 5g | 1456.40 Pln |
| purity | 97% |
|---|---|
| delivery time | 3 weeks |
1-(2,4-dichloro-5-fluoro-3-nitrophenyl)ethanone (CAS 887267-36-9) is a chemical compound with the molecular formula C8H4Cl2FNO3 and a molecular weight of 252.02 g/mol. IUPAC name: 1-(2,4-dichloro-5-fluoro-3-nitrophenyl)ethanone. InChIKey: BKFPAPKXZJFNNF-UHFFFAOYSA-N.
| Molecular formula | C8H4Cl2FNO3 |
|---|---|
| Molecular weight | 252.02 g/mol |
| IUPAC name | 1-(2,4-dichloro-5-fluoro-3-nitrophenyl)ethanone |
| InChIKey | BKFPAPKXZJFNNF-UHFFFAOYSA-N |
| SMILES | CC(=O)C1=CC(=C(C(=C1Cl)[N+](=O)[O-])Cl)F |
Computed by PubChem (NCBI)