cas: 887267-36-9 — see every product listed under this CAS number, including other names
1-(2,4-Dichloro-5-fluoro-3-nitrophenyl)ethanone, 97% (CAS 887267-36-9) is a chemical reagent available from Chemat. Available pack sizes: 25g, 250mg, 10g, 1g, 5g. Offered by: AmBeed, Fluorochem.
| brand | AmBeed |
|---|---|
| catalog number | A497779-25g |
| cas | 887267-36-9 |
| size | 25g |
| availability | Synthetic Items: 0g |
| brand | size | price | |
|---|---|---|---|
| AmBeed | 25g | 5258.47 Pln | |
| AmBeed | 250mg | 799.12 Pln | |
| AmBeed | 10g | 4067.14 Pln | |
| Fluorochem | 250mg | 227.02 Pln | |
| Fluorochem | 1g | 299.91 Pln | |
| Fluorochem | 5g | 909.07 Pln | |
| Fluorochem | 10g | 1762.94 Pln | |
| Fluorochem | 25g | 3283.24 Pln |
| purity | 97% |
|---|---|
| delivery time | To be confirmed by Chemat |
1-(2,4-dichloro-5-fluoro-3-nitrophenyl)ethanone (CAS 887267-36-9) is a chemical compound with the molecular formula C8H4Cl2FNO3 and a molecular weight of 252.02 g/mol. IUPAC name: 1-(2,4-dichloro-5-fluoro-3-nitrophenyl)ethanone. InChIKey: BKFPAPKXZJFNNF-UHFFFAOYSA-N.
| Molecular formula | C8H4Cl2FNO3 |
|---|---|
| Molecular weight | 252.02 g/mol |
| IUPAC name | 1-(2,4-dichloro-5-fluoro-3-nitrophenyl)ethanone |
| InChIKey | BKFPAPKXZJFNNF-UHFFFAOYSA-N |
| SMILES | CC(=O)C1=CC(=C(C(=C1Cl)[N+](=O)[O-])Cl)F |
Computed by PubChem (NCBI)