cas: 1141669-81-9 — see every product listed under this CAS number, including other names
1-(2,4-Diethoxyphenyl)ethanol, ≥95%, ≥95% (CAS 1141669-81-9) is a chemical reagent available from Chemat. Available pack sizes: 100mg, 250mg, 1g, 5g, 25g. Offered by: Chemat.
| brand | Chemat |
|---|---|
| catalog number | Ch111APK-100mg |
| cas | 1141669-81-9 |
| size | 100mg |
| availability | 50g |
| brand | size | price | |
|---|---|---|---|
| Chemat | 100mg | 237.20 Pln | |
| Chemat | 250mg | 270.80 Pln | |
| Chemat | 1g | 338.00 Pln | |
| Chemat | 5g | 952.40 Pln | |
| Chemat | 25g | 2589.20 Pln |
| purity | ≥95% |
|---|---|
| delivery time | 3 weeks |
1-(2,4-diethoxyphenyl)ethanol (CAS 1141669-81-9) is a chemical compound with the molecular formula C12H18O3 and a molecular weight of 210.27 g/mol. IUPAC name: 1-(2,4-diethoxyphenyl)ethanol. InChIKey: HLEWKJICLMIORG-UHFFFAOYSA-N.
| Molecular formula | C12H18O3 |
|---|---|
| Molecular weight | 210.27 g/mol |
| IUPAC name | 1-(2,4-diethoxyphenyl)ethanol |
| InChIKey | HLEWKJICLMIORG-UHFFFAOYSA-N |
| SMILES | CCOC1=CC(=C(C=C1)C(C)O)OCC |
Computed by PubChem (NCBI)