cas: 1141669-81-9 — see every product listed under this CAS number, including other names
1-(2,4-Diethoxyphenyl)ethanol (CAS 1141669-81-9) is a chemical reagent available from Chemat. Available pack sizes: 1g, 5g, 25g. Offered by: Fluorochem.
| brand | Fluorochem |
|---|---|
| catalog number | F446503-1G |
| cas | 1141669-81-9 |
| size | 1g |
| brand | size | price | |
|---|---|---|---|
| Fluorochem | 1g | 534.20 Pln | |
| Fluorochem | 5g | 1549.47 Pln | |
| Fluorochem | 25g | 4262.06 Pln |
| delivery time | 3-4 weeks |
|---|
1-(2,4-diethoxyphenyl)ethanol (CAS 1141669-81-9) is a chemical compound with the molecular formula C12H18O3 and a molecular weight of 210.27 g/mol. IUPAC name: 1-(2,4-diethoxyphenyl)ethanol. InChIKey: HLEWKJICLMIORG-UHFFFAOYSA-N.
| Molecular formula | C12H18O3 |
|---|---|
| Molecular weight | 210.27 g/mol |
| IUPAC name | 1-(2,4-diethoxyphenyl)ethanol |
| InChIKey | HLEWKJICLMIORG-UHFFFAOYSA-N |
| SMILES | CCOC1=CC(=C(C=C1)C(C)O)OCC |
Computed by PubChem (NCBI)