1-(2,4-Difluorophenyl)cyclopropanamine hydrochloride, >95%, >95%
cas: 1186663-18-2 — see every product listed under this CAS number, including other names
1-(2,4-Difluorophenyl)cyclopropanamine hydrochloride, >95%, >95% (CAS 1186663-18-2) is a chemical reagent available from Chemat. Available pack sizes: 100mg, 250mg, 1g, 5g, 10g, 25g. Offered by: Chemat.
| brand | Chemat |
|---|---|
| catalog number | Ch114CST-100mg |
| cas | 1186663-18-2 |
| size | 100mg |
| availability | 125g |
Available pack sizes
| brand | size | price | |
|---|---|---|---|
| Chemat | 100mg | 146.00 Pln | |
| Chemat | 250mg | 160.40 Pln | |
| Chemat | 1g | 448.40 Pln | |
| Chemat | 5g | 1994.00 Pln | |
| Chemat | 10g | 3851.60 Pln | |
| Chemat | 25g | 7643.60 Pln |
properties
| purity | >95% |
|---|---|
| delivery time | 3 weeks |
Methyl 2-(pyrrolidine-2-carbonylamino)acetate;2,2,2-trifluoroacetic acid (CAS 1186663-18-2) is a chemical compound with the molecular formula C10H15F3N2O5 and a molecular weight of 300.23 g/mol. IUPAC name: methyl 2-(pyrrolidine-2-carbonylamino)acetate;2,2,2-trifluoroacetic acid. InChIKey: QMLSRQCKLLGODS-UHFFFAOYSA-N.
| Molecular formula | C10H15F3N2O5 |
|---|---|
| Molecular weight | 300.23 g/mol |
| IUPAC name | methyl 2-(pyrrolidine-2-carbonylamino)acetate;2,2,2-trifluoroacetic acid |
| InChIKey | QMLSRQCKLLGODS-UHFFFAOYSA-N |
| SMILES | COC(=O)CNC(=O)C1CCCN1.C(=O)(C(F)(F)F)O |
Computed by PubChem (NCBI)
Synonyms:
Trifluoroacetic acid--methyl prolylglycinate (1/1), 2-(2-Methoxy-2-oxoethylcarbamoyl)pyrrolidine Trifluoroacetate, methyl 2-{[(2S)-pyrrolidin-2-yl]formamido}acetate; trifluoroacetic acid, DL-Methyl prolylglycinate, 2,2,2-trifluoroacetate salt, methyl 2-(pyrrolidine-2-carbonylamino)acetate;2,2,2-trifluoroacetic acid