cas: 1186663-18-2 — see every product listed under this CAS number, including other names
1-(2,4-Difluorophenyl)cyclopropanamine hydrochloride (CAS 1186663-18-2) is a chemical reagent available from Chemat. Available pack sizes: 1g, 5g, 10g, 25g. Offered by: Fluorochem.
| brand | Fluorochem |
|---|---|
| catalog number | F446399-1G |
| cas | 1186663-18-2 |
| size | 1g |
| brand | size | price | |
|---|---|---|---|
| Fluorochem | 1g | 716.43 Pln | |
| Fluorochem | 5g | 3278.03 Pln | |
| Fluorochem | 10g | 6349.87 Pln | |
| Fluorochem | 25g | 12634.11 Pln |
| delivery time | 3-4 weeks |
|---|
Methyl 2-(pyrrolidine-2-carbonylamino)acetate;2,2,2-trifluoroacetic acid (CAS 1186663-18-2) is a chemical compound with the molecular formula C10H15F3N2O5 and a molecular weight of 300.23 g/mol. IUPAC name: methyl 2-(pyrrolidine-2-carbonylamino)acetate;2,2,2-trifluoroacetic acid. InChIKey: QMLSRQCKLLGODS-UHFFFAOYSA-N.
| Molecular formula | C10H15F3N2O5 |
|---|---|
| Molecular weight | 300.23 g/mol |
| IUPAC name | methyl 2-(pyrrolidine-2-carbonylamino)acetate;2,2,2-trifluoroacetic acid |
| InChIKey | QMLSRQCKLLGODS-UHFFFAOYSA-N |
| SMILES | COC(=O)CNC(=O)C1CCCN1.C(=O)(C(F)(F)F)O |
Computed by PubChem (NCBI)