cas: 1314763-76-2 — see every product listed under this CAS number, including other names
1-(2,4-Dimethoxyphenyl)cyclopropanecarboxylic Acid, ≥95%, ≥95% (CAS 1314763-76-2) is a chemical reagent available from Chemat. Available pack sizes: 1g. Offered by: Chemat.
| brand | Chemat |
|---|---|
| catalog number | Ch111W03-1g |
| cas | 1314763-76-2 |
| size | 1g |
| availability | 4g |
| brand | size | price | |
|---|---|---|---|
| Chemat | 1g | 4163.60 Pln |
| purity | ≥95% |
|---|---|
| delivery time | 3 weeks |
1-(2,4-dimethoxyphenyl)cyclopropane-1-carboxylic acid (CAS 1314763-76-2) is a chemical compound with the molecular formula C12H14O4 and a molecular weight of 222.24 g/mol. IUPAC name: 1-(2,4-dimethoxyphenyl)cyclopropane-1-carboxylic acid. InChIKey: GOOSRQYGRHGCPV-UHFFFAOYSA-N.
| Molecular formula | C12H14O4 |
|---|---|
| Molecular weight | 222.24 g/mol |
| IUPAC name | 1-(2,4-dimethoxyphenyl)cyclopropane-1-carboxylic acid |
| InChIKey | GOOSRQYGRHGCPV-UHFFFAOYSA-N |
| SMILES | COC1=CC(=C(C=C1)C2(CC2)C(=O)O)OC |
Computed by PubChem (NCBI)