cas: 21766-81-4 — see every product listed under this CAS number, including other names
1-(2,5-Bis(benzyloxy)phenyl)ethanone 97% (CAS 21766-81-4) is a chemical reagent available from Chemat. Available pack sizes: 1g, 5g, 25g. Offered by: Ambeed.
| brand | Ambeed |
|---|---|
| catalog number | A431703-1g |
| cas | 21766-81-4 |
| size | 1g |
| brand | size | price | |
|---|---|---|---|
| Ambeed | 1g | 120.06 Pln | |
| Ambeed | 5g | 192.38 Pln | |
| Ambeed | 25g | 587.31 Pln |
| purity | 97% |
|---|---|
| delivery time | 1-2 weeks |
| ambeed catalog no. | A431703 |
1-[2,5-bis(phenylmethoxy)phenyl]ethanone (CAS 21766-81-4) is a chemical compound with the molecular formula C22H20O3 and a molecular weight of 332.4 g/mol. IUPAC name: 1-[2,5-bis(phenylmethoxy)phenyl]ethanone. InChIKey: UQJUOEWQZNRLJJ-UHFFFAOYSA-N.
| Molecular formula | C22H20O3 |
|---|---|
| Molecular weight | 332.4 g/mol |
| IUPAC name | 1-[2,5-bis(phenylmethoxy)phenyl]ethanone |
| InChIKey | UQJUOEWQZNRLJJ-UHFFFAOYSA-N |
| SMILES | CC(=O)C1=C(C=CC(=C1)OCC2=CC=CC=C2)OCC3=CC=CC=C3 |
Computed by PubChem (NCBI)