cas: 21766-81-4 — see every product listed under this CAS number, including other names
1-(2,5-Bis(benzyloxy)phenyl)ethanone, 98%, 98% (CAS 21766-81-4) is a chemical reagent available from Chemat. Available pack sizes: 250mg, 1g, 5g. Offered by: Chemat.
| brand | Chemat |
|---|---|
| catalog number | Ch11BJO2-250mg |
| cas | 21766-81-4 |
| size | 250mg |
| availability | 40g |
| brand | size | price | |
|---|---|---|---|
| Chemat | 250mg | 88.40 Pln | |
| Chemat | 1g | 107.60 Pln | |
| Chemat | 5g | 227.60 Pln |
| purity | 98% |
|---|---|
| delivery time | 3 weeks |
1-[2,5-bis(phenylmethoxy)phenyl]ethanone (CAS 21766-81-4) is a chemical compound with the molecular formula C22H20O3 and a molecular weight of 332.4 g/mol. IUPAC name: 1-[2,5-bis(phenylmethoxy)phenyl]ethanone. InChIKey: UQJUOEWQZNRLJJ-UHFFFAOYSA-N.
| Molecular formula | C22H20O3 |
|---|---|
| Molecular weight | 332.4 g/mol |
| IUPAC name | 1-[2,5-bis(phenylmethoxy)phenyl]ethanone |
| InChIKey | UQJUOEWQZNRLJJ-UHFFFAOYSA-N |
| SMILES | CC(=O)C1=C(C=CC(=C1)OCC2=CC=CC=C2)OCC3=CC=CC=C3 |
Computed by PubChem (NCBI)