cas: 618442-06-1 — see every product listed under this CAS number, including other names
1-(2,4-Dimethylphenyl)-3,5-diphenyl-1H-pyrazole, 95%, 95% (CAS 618442-06-1) is a chemical reagent available from Chemat. Available pack sizes: 100mg, 250mg, 1g. Offered by: Chemat.
| brand | Chemat |
|---|---|
| catalog number | Ch114CSW-100mg |
| cas | 618442-06-1 |
| size | 100mg |
| availability | 2g |
| brand | size | price | |
|---|---|---|---|
| Chemat | 100mg | 611.60 Pln | |
| Chemat | 250mg | 1096.40 Pln | |
| Chemat | 1g | 2819.60 Pln |
| purity | 95% |
|---|---|
| delivery time | 3 weeks |
1-(2,4-dimethylphenyl)-3,5-diphenylpyrazole (CAS 618442-06-1) is a chemical compound with the molecular formula C23H20N2 and a molecular weight of 324.4 g/mol. IUPAC name: 1-(2,4-dimethylphenyl)-3,5-diphenylpyrazole. InChIKey: CRAFVFBHLRLVMP-UHFFFAOYSA-N.
| Molecular formula | C23H20N2 |
|---|---|
| Molecular weight | 324.4 g/mol |
| IUPAC name | 1-(2,4-dimethylphenyl)-3,5-diphenylpyrazole |
| InChIKey | CRAFVFBHLRLVMP-UHFFFAOYSA-N |
| SMILES | CC1=CC(=C(C=C1)N2C(=CC(=N2)C3=CC=CC=C3)C4=CC=CC=C4)C |
Computed by PubChem (NCBI)