CAS 618442-06-1 appears in our catalog under these names: 1–(2,4–Dimethylphenyl)–3,5–diphenyl–1H–pyrazole, 1-(2,4-Dimethylphenyl)-3,5-diphenyl-1h-pyrazole, 95%, 1-(2,4-Dimethylphenyl)-3,5-diphenyl-1H-pyrazole, 95%, 95%. Offered by: GLPBio, Combi-blocks, Chemat, Fluorochem. Available pack sizes: 1g, 250mg, 100mg.
1-(2,4-dimethylphenyl)-3,5-diphenylpyrazole (CAS 618442-06-1) is a chemical compound with the molecular formula C23H20N2 and a molecular weight of 324.4 g/mol. IUPAC name: 1-(2,4-dimethylphenyl)-3,5-diphenylpyrazole. InChIKey: CRAFVFBHLRLVMP-UHFFFAOYSA-N.
| Molecular formula | C23H20N2 |
|---|---|
| Molecular weight | 324.4 g/mol |
| IUPAC name | 1-(2,4-dimethylphenyl)-3,5-diphenylpyrazole |
| InChIKey | CRAFVFBHLRLVMP-UHFFFAOYSA-N |
| SMILES | CC1=CC(=C(C=C1)N2C(=CC(=N2)C3=CC=CC=C3)C4=CC=CC=C4)C |
Computed by PubChem (NCBI)