cas: 3886-19-9 — see every product listed under this CAS number, including other names
1-(2,6-Bis(Benzyloxy)Phenyl)Ethanone, 95%, 95% (CAS 3886-19-9) is a chemical reagent available from Chemat. Available pack sizes: 100mg, 250mg, 1g. Offered by: Chemat.
| brand | Chemat |
|---|---|
| catalog number | Ch11I8P6-100mg |
| cas | 3886-19-9 |
| size | 100mg |
| availability | 4g |
| brand | size | price | |
|---|---|---|---|
| Chemat | 100mg | 136.40 Pln | |
| Chemat | 250mg | 232.40 Pln | |
| Chemat | 1g | 510.80 Pln |
| purity | 95% |
|---|---|
| delivery time | 3 weeks |
1-[2,6-bis(phenylmethoxy)phenyl]ethanone (CAS 3886-19-9) is a chemical compound with the molecular formula C22H20O3 and a molecular weight of 332.4 g/mol. IUPAC name: 1-[2,6-bis(phenylmethoxy)phenyl]ethanone. InChIKey: ZQJARFAIOBJZSO-UHFFFAOYSA-N.
| Molecular formula | C22H20O3 |
|---|---|
| Molecular weight | 332.4 g/mol |
| IUPAC name | 1-[2,6-bis(phenylmethoxy)phenyl]ethanone |
| InChIKey | ZQJARFAIOBJZSO-UHFFFAOYSA-N |
| SMILES | CC(=O)C1=C(C=CC=C1OCC2=CC=CC=C2)OCC3=CC=CC=C3 |
Computed by PubChem (NCBI)