CAS 95061-51-1 appears in our catalog under these names: (S)-2-Hydroxy-1,2,2-triphenylethyl Acetate, (S)-2-Hydroxy-1,2,2-triphenylethyl acetate 95%, (S)-2-Hydroxy-1,2,2-triphenylethyl acetate, 98%, 98%, (S)-2-Hydroxy-1,2,2-triphenylethyl acetate, 95%. Offered by: TRC, Ambeed, Chemat, Fluorochem. Available pack sizes: 2,5g, 250mg, 1g, 5g, 25g.
[(1S)-2-hydroxy-1,2,2-triphenylethyl] acetate (CAS 95061-51-1) is a chemical compound with the molecular formula C22H20O3 and a molecular weight of 332.4 g/mol. IUPAC name: [(1S)-2-hydroxy-1,2,2-triphenylethyl] acetate. InChIKey: GXLZCXZLVDUDHP-NRFANRHFSA-N.
| Molecular formula | C22H20O3 |
|---|---|
| Molecular weight | 332.4 g/mol |
| IUPAC name | [(1S)-2-hydroxy-1,2,2-triphenylethyl] acetate |
| InChIKey | GXLZCXZLVDUDHP-NRFANRHFSA-N |
| SMILES | CC(=O)O[C@@H](C1=CC=CC=C1)C(C2=CC=CC=C2)(C3=CC=CC=C3)O |
Computed by PubChem (NCBI)