cas: 131274-17-4 — see every product listed under this CAS number, including other names
1-(2-(2-Aminoethoxy)ethyl)-1H-pyrrole-2,5-dione 2,2,2-trifluoroacetate, 97% (CAS 131274-17-4) is a chemical reagent available from Chemat. Available pack sizes: 100mg, 250mg, 500mg, 1g, 5g, 10g, 25g, 100g. Offered by: Fluorochem.
| brand | Fluorochem |
|---|---|
| catalog number | F497166-100MG |
| cas | 131274-17-4 |
| size | 100mg |
| availability | In Stock China |
Ask us about this product — we're happy to help.
| brand | size | price | |
|---|---|---|---|
| Fluorochem | 100mg | 305.12 Pln | |
| Fluorochem | 250mg | 435.28 Pln | |
| Fluorochem | 500mg | 700.81 Pln | |
| Fluorochem | 1g | 976.76 Pln | |
| Fluorochem | 5g | 2611.60 Pln | |
| Fluorochem | 10g | 4579.66 Pln | |
| Fluorochem | 25g | 8911.46 Pln | |
| Fluorochem | 100g | 30601.74 Pln |
| purity | 97% |
|---|---|
| dual use | No |
| currency | EUR |
| delivery time | 3-4 weeks |
| category | Odczynniki chemiczne |
1-[2-(2-aminoethoxy)ethyl]pyrrole-2,5-dione;2,2,2-trifluoroacetic acid (CAS 131274-17-4) is a chemical compound with the molecular formula C10H13F3N2O5 and a molecular weight of 298.22 g/mol. IUPAC name: 1-[2-(2-aminoethoxy)ethyl]pyrrole-2,5-dione;2,2,2-trifluoroacetic acid. InChIKey: UJHVUJSQURGBAO-UHFFFAOYSA-N.
| Molecular formula | C10H13F3N2O5 |
|---|---|
| Molecular weight | 298.22 g/mol |
| IUPAC name | 1-[2-(2-aminoethoxy)ethyl]pyrrole-2,5-dione;2,2,2-trifluoroacetic acid |
| InChIKey | UJHVUJSQURGBAO-UHFFFAOYSA-N |
| SMILES | C1=CC(=O)N(C1=O)CCOCCN.C(=O)(C(F)(F)F)O |
Computed by PubChem (NCBI)