1-(2-(Aminomethyl)-2-methylmorpholino)-2-(dimethylamino)ethan-1-one, 95%
cas: 2137874-22-5 — see every product listed under this CAS number, including other names
1-(2-(Aminomethyl)-2-methylmorpholino)-2-(dimethylamino)ethan-1-one, 95% (CAS 2137874-22-5) is a chemical reagent available from Chemat. Available pack sizes: 25mg, 50mg, 100mg, 250mg, 1g, 5g. Offered by: Ambeed, BLDpharm.
| brand | Ambeed |
|---|---|
| catalog number | A2896239-25mg |
| cas | 2137874-22-5 |
| size | 25mg |
Need more information?
Ask us about this product — we're happy to help.
Available pack sizes
| brand | size | price | |
|---|---|---|---|
| Ambeed | 25mg | 448.25 Pln | |
| Ambeed | 50mg | 709.69 Pln | |
| Ambeed | 100mg | 1165.81 Pln | |
| Ambeed | 250mg | 2033.56 Pln | |
| Ambeed | 1g | 5359.94 Pln | |
| Ambeed | 5g | 21235.31 Pln | |
| BLDpharm | 25mg | 475.41 Pln | |
| BLDpharm | 50mg | 758.65 Pln | |
| BLDpharm | 100mg | 1252.92 Pln | |
| BLDpharm | 250mg | 2185.92 Pln | |
| BLDpharm | 1g | 5773.55 Pln | |
| BLDpharm | 5g | 22895.30 Pln |
properties
| purity | 95% |
|---|---|
| delivery time | 2-3 weeks |
1-[2-(aminomethyl)-2-methylmorpholin-4-yl]-2-(dimethylamino)ethanone (CAS 2137874-22-5) is a chemical compound with the molecular formula C10H21N3O2 and a molecular weight of 215.29 g/mol. IUPAC name: 1-[2-(aminomethyl)-2-methylmorpholin-4-yl]-2-(dimethylamino)ethanone. InChIKey: OGPISETXCXXUIY-UHFFFAOYSA-N.
| Molecular formula | C10H21N3O2 |
|---|---|
| Molecular weight | 215.29 g/mol |
| IUPAC name | 1-[2-(aminomethyl)-2-methylmorpholin-4-yl]-2-(dimethylamino)ethanone |
| InChIKey | OGPISETXCXXUIY-UHFFFAOYSA-N |
| SMILES | CC1(CN(CCO1)C(=O)CN(C)C)CN |
Computed by PubChem (NCBI)