CAS 1516186-33-6 is the registry number for tert-Butyl (3-amino-3-imino-2,2-dimethylpropyl)carbamate, 98%. Offered by: Chemat Brand. Available pack sizes: on request.
Tert-butyl N-(3-amino-3-imino-2,2-dimethylpropyl)carbamate (CAS 1516186-33-6) is a chemical compound with the molecular formula C10H21N3O2 and a molecular weight of 215.29 g/mol. IUPAC name: tert-butyl N-(3-amino-3-imino-2,2-dimethylpropyl)carbamate. InChIKey: HXCISCJVRAGCQF-UHFFFAOYSA-N.
| Molecular formula | C10H21N3O2 |
|---|---|
| Molecular weight | 215.29 g/mol |
| IUPAC name | tert-butyl N-(3-amino-3-imino-2,2-dimethylpropyl)carbamate |
| InChIKey | HXCISCJVRAGCQF-UHFFFAOYSA-N |
| SMILES | CC(C)(C)OC(=O)NCC(C)(C)C(=N)N |
Computed by PubChem (NCBI)