1-(2-(Trifluoromethoxy)phenyl)ethanol, 95%, 95%
cas: 910442-37-4 — see every product listed under this CAS number, including other names
1-(2-(Trifluoromethoxy)phenyl)ethanol, 95%, 95% (CAS 910442-37-4) is a chemical reagent available from Chemat. Available pack sizes: 1g, 5g, 100mg, 250mg, 500mg, 10g. Offered by: Chemat.
| brand | Chemat |
|---|---|
| catalog number | Ch11H1UB-1g |
| cas | 910442-37-4 |
| size | 1g |
| availability | 30g |
Available pack sizes
| brand | size | price | |
|---|---|---|---|
| Chemat | 1g | 5757.20 Pln | |
| Chemat | 5g | 16562.00 Pln | |
| Chemat | 100mg | 5066.00 Pln | |
| Chemat | 250mg | 5296.40 Pln | |
| Chemat | 500mg | 5526.80 Pln | |
| Chemat | 10g | 24534.80 Pln |
properties
| purity | 95% |
|---|---|
| delivery time | 3 weeks |
1-[2-(trifluoromethoxy)phenyl]ethanol (CAS 910442-37-4) is a chemical compound with the molecular formula C9H9F3O2 and a molecular weight of 206.16 g/mol. IUPAC name: 1-[2-(trifluoromethoxy)phenyl]ethanol. InChIKey: LWOXLMRGAQEYMM-UHFFFAOYSA-N.
| Molecular formula | C9H9F3O2 |
|---|---|
| Molecular weight | 206.16 g/mol |
| IUPAC name | 1-[2-(trifluoromethoxy)phenyl]ethanol |
| InChIKey | LWOXLMRGAQEYMM-UHFFFAOYSA-N |
| SMILES | CC(C1=CC=CC=C1OC(F)(F)F)O |
Computed by PubChem (NCBI)