Products 286441-68-7
CAS 286441-68-7 appears in our catalog under these names: 2-Methoxy-4-(trifluoromethyl)benzyl alcohol, 95%, 2-Methoxy-4-(trifluoromethyl)benzyl alcohol 95%, 2-Methoxy-4-(trifluoromethyl)benzyl alcohol, 98%, 98%, 2-Methoxy-4-(trifluoromethyl)benzyl alcohol, 98%. Offered by: Combi-blocks, Ambeed, Chemat, Fluorochem. Available pack sizes: 1g, 5g, 250mg, 25g, 100mg, 10g, 100g.
[2-methoxy-4-(trifluoromethyl)phenyl]methanol (CAS 286441-68-7) is a chemical compound with the molecular formula C9H9F3O2 and a molecular weight of 206.16 g/mol. IUPAC name: [2-methoxy-4-(trifluoromethyl)phenyl]methanol. InChIKey: OHEBPFPPZUWWHD-UHFFFAOYSA-N.
| Molecular formula | C9H9F3O2 |
|---|---|
| Molecular weight | 206.16 g/mol |
| IUPAC name | [2-methoxy-4-(trifluoromethyl)phenyl]methanol |
| InChIKey | OHEBPFPPZUWWHD-UHFFFAOYSA-N |
| SMILES | COC1=C(C=CC(=C1)C(F)(F)F)CO |
Computed by PubChem (NCBI)