cas: 832113-73-2 — see every product listed under this CAS number, including other names
1-(2-Aminothiophene-3-yl)-2,2-dimethylpropan-1-one (CAS 832113-73-2) is a chemical reagent available from Chemat. Available pack sizes: 1g, 5g, 10g, 25g. Offered by: Fluorochem.
| brand | Fluorochem |
|---|---|
| catalog number | F021700-1G |
| cas | 832113-73-2 |
| size | 1g |
| brand | size | price | |
|---|---|---|---|
| Fluorochem | 1g | 164.54 Pln | |
| Fluorochem | 5g | 570.65 Pln | |
| Fluorochem | 10g | 851.80 Pln | |
| Fluorochem | 25g | 2392.93 Pln |
| delivery time | 2-3 weeks |
|---|
1-(2-aminothiophen-3-yl)-2,2-dimethylpropan-1-one (CAS 832113-73-2) is a chemical compound with the molecular formula C9H13NOS and a molecular weight of 183.27 g/mol. IUPAC name: 1-(2-aminothiophen-3-yl)-2,2-dimethylpropan-1-one. InChIKey: DDWJLNLMGDGIEI-UHFFFAOYSA-N.
| Molecular formula | C9H13NOS |
|---|---|
| Molecular weight | 183.27 g/mol |
| IUPAC name | 1-(2-aminothiophen-3-yl)-2,2-dimethylpropan-1-one |
| InChIKey | DDWJLNLMGDGIEI-UHFFFAOYSA-N |
| SMILES | CC(C)(C)C(=O)C1=C(SC=C1)N |
Computed by PubChem (NCBI)