CAS 832113-73-2 appears in our catalog under these names: 1-(2-Aminothiophen-3-yl)-2,2-dimethylpropan-1-one, 95%, 1-(2-Aminothiophen-3-yl)-2,2-dimethylpropan-1-one, 1-(2-Aminothiophene-3-yl)-2,2-dimethylpropan-1-one, 99%. Offered by: Combi-blocks, Biosynth, Fluorochem. Available pack sizes: 10g, 1g, 5g, 2,5g, 0,25g, 25g.
1-(2-aminothiophen-3-yl)-2,2-dimethylpropan-1-one (CAS 832113-73-2) is a chemical compound with the molecular formula C9H13NOS and a molecular weight of 183.27 g/mol. IUPAC name: 1-(2-aminothiophen-3-yl)-2,2-dimethylpropan-1-one. InChIKey: DDWJLNLMGDGIEI-UHFFFAOYSA-N.
| Molecular formula | C9H13NOS |
|---|---|
| Molecular weight | 183.27 g/mol |
| IUPAC name | 1-(2-aminothiophen-3-yl)-2,2-dimethylpropan-1-one |
| InChIKey | DDWJLNLMGDGIEI-UHFFFAOYSA-N |
| SMILES | CC(C)(C)C(=O)C1=C(SC=C1)N |
Computed by PubChem (NCBI)