cas: 85737-06-0 — see every product listed under this CAS number, including other names
1-(2-Bromo-1,1,2,2-tetrafluoroethoxy)-1,2,2-trifluoroethene, 98%, 98% (CAS 85737-06-0) is a chemical reagent available from Chemat. Available pack sizes: 250mg, 500mg, 1g, 500g, 1kg. Offered by: Chemat.
| brand | Chemat |
|---|---|
| catalog number | Ch115S88-250mg |
| cas | 85737-06-0 |
| size | 250mg |
| availability | 66000g |
| brand | size | price | |
|---|---|---|---|
| Chemat | 250mg | 117.20 Pln | |
| Chemat | 500mg | 165.20 Pln | |
| Chemat | 1g | 227.60 Pln | |
| Chemat | 500g | 11059.20 Pln | |
| Chemat | 1kg | 19086.80 Pln |
| purity | 98% |
|---|---|
| delivery time | 3 weeks |
1-bromo-1,1,2,2-tetrafluoro-2-(1,2,2-trifluoroethenoxy)ethane (CAS 85737-06-0) is a chemical compound with the molecular formula C4BrF7O and a molecular weight of 276.93 g/mol. IUPAC name: 1-bromo-1,1,2,2-tetrafluoro-2-(1,2,2-trifluoroethenoxy)ethane. InChIKey: ZPYGRBTUNITHKJ-UHFFFAOYSA-N.
| Molecular formula | C4BrF7O |
|---|---|
| Molecular weight | 276.93 g/mol |
| IUPAC name | 1-bromo-1,1,2,2-tetrafluoro-2-(1,2,2-trifluoroethenoxy)ethane |
| InChIKey | ZPYGRBTUNITHKJ-UHFFFAOYSA-N |
| SMILES | C(=C(F)F)(OC(C(F)(F)Br)(F)F)F |
Computed by PubChem (NCBI)