CAS 85737-06-0 appears in our catalog under these names: 2-Bromotetrafluoroethyl trifluorovinyl ether, 95%, 2-Bromotetrafluoroethyl Trifluorovinyl Ether (stabilized with MEHQ), >98.0%(GC), 1-(2-Bromo-1,1,2,2-tetrafluoroethoxy)-1,2,2-trifluoroethene, 98%, 98%, 2-Bromotetrafluoroethyl trifluorovinyl ether, 97%. Offered by: Combi-blocks, TCI, Chemat, Fluorochem. Available pack sizes: 1g, 5g, 25g, 250mg, 500mg, 500g, 1kg.
1-bromo-1,1,2,2-tetrafluoro-2-(1,2,2-trifluoroethenoxy)ethane (CAS 85737-06-0) is a chemical compound with the molecular formula C4BrF7O and a molecular weight of 276.93 g/mol. IUPAC name: 1-bromo-1,1,2,2-tetrafluoro-2-(1,2,2-trifluoroethenoxy)ethane. InChIKey: ZPYGRBTUNITHKJ-UHFFFAOYSA-N.
| Molecular formula | C4BrF7O |
|---|---|
| Molecular weight | 276.93 g/mol |
| IUPAC name | 1-bromo-1,1,2,2-tetrafluoro-2-(1,2,2-trifluoroethenoxy)ethane |
| InChIKey | ZPYGRBTUNITHKJ-UHFFFAOYSA-N |
| SMILES | C(=C(F)F)(OC(C(F)(F)Br)(F)F)F |
Computed by PubChem (NCBI)