cas: 244229-34-3 — see every product listed under this CAS number, including other names
1-(2-Bromophenyl)-2,2,2-trifluoroethanone 95% (CAS 244229-34-3) is a chemical reagent available from Chemat. Available pack sizes: 100mg, 250mg, 1g, 5g. Offered by: Ambeed.
| brand | Ambeed |
|---|---|
| catalog number | A300217-100mg |
| cas | 244229-34-3 |
| size | 100mg |
| brand | size | price | |
|---|---|---|---|
| Ambeed | 100mg | 331.44 Pln | |
| Ambeed | 250mg | 381.50 Pln | |
| Ambeed | 1g | 553.94 Pln | |
| Ambeed | 5g | 1616.38 Pln |
| purity | 95% |
|---|---|
| delivery time | 1-2 weeks |
| ambeed catalog no. | A300217 |
1-(2-bromophenyl)-2,2,2-trifluoroethanone (CAS 244229-34-3) is a chemical compound with the molecular formula C8H4BrF3O and a molecular weight of 253.02 g/mol. IUPAC name: 1-(2-bromophenyl)-2,2,2-trifluoroethanone. InChIKey: VNAWTGXXPNWISR-UHFFFAOYSA-N.
| Molecular formula | C8H4BrF3O |
|---|---|
| Molecular weight | 253.02 g/mol |
| IUPAC name | 1-(2-bromophenyl)-2,2,2-trifluoroethanone |
| InChIKey | VNAWTGXXPNWISR-UHFFFAOYSA-N |
| SMILES | C1=CC=C(C(=C1)C(=O)C(F)(F)F)Br |
Computed by PubChem (NCBI)