CAS 244229-34-3 appears in our catalog under these names: 1-(2-Bromophenyl)-2,2,2-trifluoroethanone, 95%, 1-(2-Bromophenyl)-2,2,2-trifluoroethanone 95%, 1-(2-Bromophenyl)-2,2,2-trifluoroethanone, 95%, 95%, 1-(2-Bromophenyl)-2,2,2-trifluoroethanone, 96%. Offered by: Combi-blocks, Ambeed, Chemat, Fluorochem. Available pack sizes: 1g, 5g, 100mg, 250mg, 25g.
1-(2-bromophenyl)-2,2,2-trifluoroethanone (CAS 244229-34-3) is a chemical compound with the molecular formula C8H4BrF3O and a molecular weight of 253.02 g/mol. IUPAC name: 1-(2-bromophenyl)-2,2,2-trifluoroethanone. InChIKey: VNAWTGXXPNWISR-UHFFFAOYSA-N.
| Molecular formula | C8H4BrF3O |
|---|---|
| Molecular weight | 253.02 g/mol |
| IUPAC name | 1-(2-bromophenyl)-2,2,2-trifluoroethanone |
| InChIKey | VNAWTGXXPNWISR-UHFFFAOYSA-N |
| SMILES | C1=CC=C(C(=C1)C(=O)C(F)(F)F)Br |
Computed by PubChem (NCBI)