CAS 1402174-38-2 is the registry number for 1-(2-Chlorophenyl)-4-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)-1H-pyrazole, 95%, 95%. Offered by: Chemat. Available pack sizes: 250mg, 1g, 5g.
1-(2-chlorophenyl)-4-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)pyrazole (CAS 1402174-38-2) is a chemical compound with the molecular formula C15H18BClN2O2 and a molecular weight of 304.6 g/mol. IUPAC name: 1-(2-chlorophenyl)-4-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)pyrazole. InChIKey: ICYYXBGUGKJLIL-UHFFFAOYSA-N.
| Molecular formula | C15H18BClN2O2 |
|---|---|
| Molecular weight | 304.6 g/mol |
| IUPAC name | 1-(2-chlorophenyl)-4-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)pyrazole |
| InChIKey | ICYYXBGUGKJLIL-UHFFFAOYSA-N |
| SMILES | B1(OC(C(O1)(C)C)(C)C)C2=CN(N=C2)C3=CC=CC=C3Cl |
Computed by PubChem (NCBI)