CAS 2246368-85-2 is the registry number for 8-Chloro-6-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)isoquinolin-3-amine, 95%. Offered by: Chemat Brand. Available pack sizes: on request.
8-chloro-6-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)isoquinolin-3-amine (CAS 2246368-85-2) is a chemical compound with the molecular formula C15H18BClN2O2 and a molecular weight of 304.6 g/mol. IUPAC name: 8-chloro-6-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)isoquinolin-3-amine. InChIKey: ZAISQGJRBLAYSC-UHFFFAOYSA-N.
| Molecular formula | C15H18BClN2O2 |
|---|---|
| Molecular weight | 304.6 g/mol |
| IUPAC name | 8-chloro-6-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)isoquinolin-3-amine |
| InChIKey | ZAISQGJRBLAYSC-UHFFFAOYSA-N |
| SMILES | B1(OC(C(O1)(C)C)(C)C)C2=CC3=CC(=NC=C3C(=C2)Cl)N |
Computed by PubChem (NCBI)