cas: 1256360-38-9 — see every product listed under this CAS number, including other names
1-(2-Fluoro-3-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)benzyl)pyrrolidine 95% (CAS 1256360-38-9) is a chemical reagent available from Chemat. Available pack sizes: 100mg, 250mg, 1g, 5g. Offered by: Ambeed.
| brand | Ambeed |
|---|---|
| catalog number | A735253-100mg |
| cas | 1256360-38-9 |
| size | 100mg |
| brand | size | price | |
|---|---|---|---|
| Ambeed | 100mg | 286.94 Pln | |
| Ambeed | 250mg | 409.31 Pln | |
| Ambeed | 1g | 909.94 Pln | |
| Ambeed | 5g | 2584.25 Pln |
| purity | 95% |
|---|---|
| delivery time | 2-3 weeks |
| ambeed catalog no. | A735253 |
1-[[2-fluoro-3-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)phenyl]methyl]pyrrolidine (CAS 1256360-38-9) is a chemical compound with the molecular formula C17H25BFNO2 and a molecular weight of 305.2 g/mol. IUPAC name: 1-[[2-fluoro-3-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)phenyl]methyl]pyrrolidine. InChIKey: QNJZSSCPNOKEAJ-UHFFFAOYSA-N.
| Molecular formula | C17H25BFNO2 |
|---|---|
| Molecular weight | 305.2 g/mol |
| IUPAC name | 1-[[2-fluoro-3-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)phenyl]methyl]pyrrolidine |
| InChIKey | QNJZSSCPNOKEAJ-UHFFFAOYSA-N |
| SMILES | B1(OC(C(O1)(C)C)(C)C)C2=C(C(=CC=C2)CN3CCCC3)F |
Computed by PubChem (NCBI)