CAS 1486485-42-0 appears in our catalog under these names: 2-Fluoro--5-pyrrolidinomethylphenylboronic acid, pinacol ester, 96%, 2-Fluoro-5-pyrrolidinomethylphenylboronic acid, pinacol ester. Offered by: Combi-blocks, Biosynth. Available pack sizes: 1g, 10g, 5g.
1-[[4-fluoro-3-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)phenyl]methyl]pyrrolidine (CAS 1486485-42-0) is a chemical compound with the molecular formula C17H25BFNO2 and a molecular weight of 305.2 g/mol. IUPAC name: 1-[[4-fluoro-3-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)phenyl]methyl]pyrrolidine. InChIKey: HZWWLSXNGSJJFI-UHFFFAOYSA-N.
| Molecular formula | C17H25BFNO2 |
|---|---|
| Molecular weight | 305.2 g/mol |
| IUPAC name | 1-[[4-fluoro-3-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)phenyl]methyl]pyrrolidine |
| InChIKey | HZWWLSXNGSJJFI-UHFFFAOYSA-N |
| SMILES | B1(OC(C(O1)(C)C)(C)C)C2=C(C=CC(=C2)CN3CCCC3)F |
Computed by PubChem (NCBI)