cas: 897615-91-7 — see every product listed under this CAS number, including other names
1-(2-Fluorophenyl)-1,2,3,4-tetrahydropyrrolo(1,2-a)pyrazine, 92% (CAS 897615-91-7) is a chemical reagent available from Chemat. Available pack sizes: 5g, 10g. Offered by: AmBeed.
| brand | AmBeed |
|---|---|
| catalog number | A694107-5g |
| cas | 897615-91-7 |
| size | 5g |
| availability | Synthetic Items: 0g |
| brand | size | price | |
|---|---|---|---|
| AmBeed | 5g | 15726.55 Pln | |
| AmBeed | 10g | 21904.54 Pln |
| purity | 92% |
|---|---|
| delivery time | To be confirmed by Chemat |
1-(2-fluorophenyl)-1,2,3,4-tetrahydropyrrolo[1,2-a]pyrazine (CAS 897615-91-7) is a chemical compound with the molecular formula C13H13FN2 and a molecular weight of 216.25 g/mol. IUPAC name: 1-(2-fluorophenyl)-1,2,3,4-tetrahydropyrrolo[1,2-a]pyrazine. InChIKey: RCGRCTXPSVQZEH-UHFFFAOYSA-N.
| Molecular formula | C13H13FN2 |
|---|---|
| Molecular weight | 216.25 g/mol |
| IUPAC name | 1-(2-fluorophenyl)-1,2,3,4-tetrahydropyrrolo[1,2-a]pyrazine |
| InChIKey | RCGRCTXPSVQZEH-UHFFFAOYSA-N |
| SMILES | C1CN2C=CC=C2C(N1)C3=CC=CC=C3F |
Computed by PubChem (NCBI)