CAS 1250244-09-7 is the registry number for 1-N-Benzyl-5-fluorobenzene-1,2-diamine, 95%. Offered by: Combi-blocks. Available pack sizes: 5g, 1g.
2-N-benzyl-4-fluorobenzene-1,2-diamine (CAS 1250244-09-7) is a chemical compound with the molecular formula C13H13FN2 and a molecular weight of 216.25 g/mol. IUPAC name: 2-N-benzyl-4-fluorobenzene-1,2-diamine. InChIKey: RMBMHNNPUYDKMS-UHFFFAOYSA-N.
| Molecular formula | C13H13FN2 |
|---|---|
| Molecular weight | 216.25 g/mol |
| IUPAC name | 2-N-benzyl-4-fluorobenzene-1,2-diamine |
| InChIKey | RMBMHNNPUYDKMS-UHFFFAOYSA-N |
| SMILES | C1=CC=C(C=C1)CNC2=C(C=CC(=C2)F)N |
Computed by PubChem (NCBI)