cas: 106795-66-8 — see every product listed under this CAS number, including other names
1-(2-Fluorophenyl)cyclohexanecarboxylic acid 95% (CAS 106795-66-8) is a chemical reagent available from Chemat. Available pack sizes: 1g, 5g. Offered by: Ambeed.
| brand | Ambeed |
|---|---|
| catalog number | A138702-1g |
| cas | 106795-66-8 |
| size | 1g |
| brand | size | price | |
|---|---|---|---|
| Ambeed | 1g | 492.75 Pln | |
| Ambeed | 5g | 1744.31 Pln |
| purity | 95% |
|---|---|
| delivery time | 1-2 weeks |
| ambeed catalog no. | A138702 |
1-(2-fluorophenyl)cyclohexane-1-carboxylic acid (CAS 106795-66-8) is a chemical compound with the molecular formula C13H15FO2 and a molecular weight of 222.25 g/mol. IUPAC name: 1-(2-fluorophenyl)cyclohexane-1-carboxylic acid. InChIKey: ODLLDVJLQPBPPC-UHFFFAOYSA-N.
| Molecular formula | C13H15FO2 |
|---|---|
| Molecular weight | 222.25 g/mol |
| IUPAC name | 1-(2-fluorophenyl)cyclohexane-1-carboxylic acid |
| InChIKey | ODLLDVJLQPBPPC-UHFFFAOYSA-N |
| SMILES | C1CCC(CC1)(C2=CC=CC=C2F)C(=O)O |
Computed by PubChem (NCBI)