cas: 847818-71-7 — see every product listed under this CAS number, including other names
1-(2-Methoxyethyl)-4-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)-1H-pyrazole, 95% (CAS 847818-71-7) is a chemical reagent available from Chemat. Available pack sizes: 250mg, 1g, 5g, 10g. Offered by: Fluorochem.
| brand | Fluorochem |
|---|---|
| catalog number | F078155-250MG |
| cas | 847818-71-7 |
| size | 250mg |
| brand | size | price | |
|---|---|---|---|
| Fluorochem | 250mg | 133.30 Pln | |
| Fluorochem | 1g | 195.78 Pln | |
| Fluorochem | 5g | 508.17 Pln | |
| Fluorochem | 10g | 955.93 Pln |
| purity | 95% |
|---|---|
| delivery time | 3-4 weeks |
1-(2-methoxyethyl)-4-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)pyrazole (CAS 847818-71-7) is a chemical compound with the molecular formula C12H21BN2O3 and a molecular weight of 252.12 g/mol. IUPAC name: 1-(2-methoxyethyl)-4-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)pyrazole. InChIKey: NZMICYAXDXTDJV-UHFFFAOYSA-N.
| Molecular formula | C12H21BN2O3 |
|---|---|
| Molecular weight | 252.12 g/mol |
| IUPAC name | 1-(2-methoxyethyl)-4-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)pyrazole |
| InChIKey | NZMICYAXDXTDJV-UHFFFAOYSA-N |
| SMILES | B1(OC(C(O1)(C)C)(C)C)C2=CN(N=C2)CCOC |
Computed by PubChem (NCBI)