Products 1609367-69-2
CAS 1609367-69-2 is the registry number for 1-(2-Methoxyethyl)-3-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)-1H-pyrazole, 95%. Offered by: Chemat Brand. Available pack sizes: on request.
1-(2-methoxyethyl)-3-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)pyrazole (CAS 1609367-69-2) is a chemical compound with the molecular formula C12H21BN2O3 and a molecular weight of 252.12 g/mol. IUPAC name: 1-(2-methoxyethyl)-3-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)pyrazole. InChIKey: QVQIZPBQZPTDAD-UHFFFAOYSA-N.
| Molecular formula | C12H21BN2O3 |
|---|---|
| Molecular weight | 252.12 g/mol |
| IUPAC name | 1-(2-methoxyethyl)-3-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)pyrazole |
| InChIKey | QVQIZPBQZPTDAD-UHFFFAOYSA-N |
| SMILES | B1(OC(C(O1)(C)C)(C)C)C2=NN(C=C2)CCOC |
Computed by PubChem (NCBI)