cas: 847818-75-1 — see every product listed under this CAS number, including other names
1-(2-Methylpropyl)-5-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)-1H-pyrazole 98% (CAS 847818-75-1) is a chemical reagent available from Chemat. Available pack sizes: 250mg, 1g, 5g. Offered by: Ambeed.
| brand | Ambeed |
|---|---|
| catalog number | A212974-250mg |
| cas | 847818-75-1 |
| size | 250mg |
| brand | size | price | |
|---|---|---|---|
| Ambeed | 250mg | 203.50 Pln | |
| Ambeed | 1g | 387.06 Pln | |
| Ambeed | 5g | 1265.94 Pln |
| purity | 98% |
|---|---|
| delivery time | 2-3 weeks |
| ambeed catalog no. | A212974 |
1-(2-methylpropyl)-5-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)pyrazole (CAS 847818-75-1) is a chemical compound with the molecular formula C13H23BN2O2 and a molecular weight of 250.15 g/mol. IUPAC name: 1-(2-methylpropyl)-5-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)pyrazole. InChIKey: UCTGHVVGYUCXFN-UHFFFAOYSA-N.
| Molecular formula | C13H23BN2O2 |
|---|---|
| Molecular weight | 250.15 g/mol |
| IUPAC name | 1-(2-methylpropyl)-5-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)pyrazole |
| InChIKey | UCTGHVVGYUCXFN-UHFFFAOYSA-N |
| SMILES | B1(OC(C(O1)(C)C)(C)C)C2=CC=NN2CC(C)C |
Computed by PubChem (NCBI)