CAS 2223047-52-5 is the registry number for 1-(2-Methylpropyl)-3-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)-1h-pyrazole, 95%. Offered by: Combi-blocks. Available pack sizes: 250mg, 5g, 1g.
1-(2-methylpropyl)-3-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)pyrazole (CAS 2223047-52-5) is a chemical compound with the molecular formula C13H23BN2O2 and a molecular weight of 250.15 g/mol. IUPAC name: 1-(2-methylpropyl)-3-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)pyrazole. InChIKey: OPNPCVUKFYMRJM-UHFFFAOYSA-N.
| Molecular formula | C13H23BN2O2 |
|---|---|
| Molecular weight | 250.15 g/mol |
| IUPAC name | 1-(2-methylpropyl)-3-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)pyrazole |
| InChIKey | OPNPCVUKFYMRJM-UHFFFAOYSA-N |
| SMILES | B1(OC(C(O1)(C)C)(C)C)C2=NN(C=C2)CC(C)C |
Computed by PubChem (NCBI)