CAS 181934-31-6 appears in our catalog under these names: 1-(2-Phenylethynyl)-1,2-benziodoxol-3(1h)-one, 95%, 1-(2-Phenylethynyl)-1,2-benziodoxol-3(1H)-one, 98%, 98%, 1-(2-Phenylethynyl)-1,2-benziodoxol-3(1H)-one, 98%. Offered by: Combi-blocks, Chemat, Fluorochem, Ambeed. Available pack sizes: 250mg, 1g, 100mg, 5g.
1-(2-phenylethynyl)-1lambda3,2-benziodoxol-3-one (CAS 181934-31-6) is a chemical compound with the molecular formula C15H9IO2 and a molecular weight of 348.13 g/mol. IUPAC name: 1-(2-phenylethynyl)-1lambda3,2-benziodoxol-3-one. InChIKey: XOIXSZAJFLMMOS-UHFFFAOYSA-N.
| Molecular formula | C15H9IO2 |
|---|---|
| Molecular weight | 348.13 g/mol |
| IUPAC name | 1-(2-phenylethynyl)-1lambda3,2-benziodoxol-3-one |
| InChIKey | XOIXSZAJFLMMOS-UHFFFAOYSA-N |
| SMILES | C1=CC=C(C=C1)C#CI2C3=CC=CC=C3C(=O)O2 |
Computed by PubChem (NCBI)