CAS 1147-00-8 is the registry number for 2-(4-Iodophenyl)-1H-indene-1,3(2H)-dione, 98%. Offered by: Chemat Brand. Available pack sizes: on request.
2-(4-iodophenyl)indene-1,3-dione (CAS 1147-00-8) is a chemical compound with the molecular formula C15H9IO2 and a molecular weight of 348.13 g/mol. IUPAC name: 2-(4-iodophenyl)indene-1,3-dione. InChIKey: UTLQYSLZKWYNOX-UHFFFAOYSA-N.
| Molecular formula | C15H9IO2 |
|---|---|
| Molecular weight | 348.13 g/mol |
| IUPAC name | 2-(4-iodophenyl)indene-1,3-dione |
| InChIKey | UTLQYSLZKWYNOX-UHFFFAOYSA-N |
| SMILES | C1=CC=C2C(=C1)C(=O)C(C2=O)C3=CC=C(C=C3)I |
Computed by PubChem (NCBI)