cas: 853745-55-8 — see every product listed under this CAS number, including other names
1-(2-bromophenyl)piperazine hydrochloride, 95%, 95% (CAS 853745-55-8) is a chemical reagent available from Chemat. Available pack sizes: 1g. Offered by: Chemat.
| brand | Chemat |
|---|---|
| catalog number | Ch12JUW1-1g |
| cas | 853745-55-8 |
| size | 1g |
| availability | 1g |
| brand | size | price | |
|---|---|---|---|
| Chemat | 1g | 539.60 Pln |
| purity | 95% |
|---|---|
| delivery time | 3 weeks |
1-(2-bromophenyl)piperazine;hydrochloride (CAS 853745-55-8) is a chemical compound with the molecular formula C10H14BrClN2 and a molecular weight of 277.59 g/mol. IUPAC name: 1-(2-bromophenyl)piperazine;hydrochloride. InChIKey: BIXLVAQDGFZJLM-UHFFFAOYSA-N.
| Molecular formula | C10H14BrClN2 |
|---|---|
| Molecular weight | 277.59 g/mol |
| IUPAC name | 1-(2-bromophenyl)piperazine;hydrochloride |
| InChIKey | BIXLVAQDGFZJLM-UHFFFAOYSA-N |
| SMILES | C1CN(CCN1)C2=CC=CC=C2Br.Cl |
Computed by PubChem (NCBI)