CAS 1352318-07-0 appears in our catalog under these names: 3-Bromo-2-piperidinopyridine hydrochloride, 97%, 3-Bromo-2-piperidinopyridine, HCl, 97%. Offered by: Combi-blocks, AmBeed. Available pack sizes: 25g, 1g, 100g, 5g.
3-bromo-2-piperidin-1-ylpyridine;hydrochloride (CAS 1352318-07-0) is a chemical compound with the molecular formula C10H14BrClN2 and a molecular weight of 277.59 g/mol. IUPAC name: 3-bromo-2-piperidin-1-ylpyridine;hydrochloride. InChIKey: PFBKQTKAJDILMJ-UHFFFAOYSA-N.
| Molecular formula | C10H14BrClN2 |
|---|---|
| Molecular weight | 277.59 g/mol |
| IUPAC name | 3-bromo-2-piperidin-1-ylpyridine;hydrochloride |
| InChIKey | PFBKQTKAJDILMJ-UHFFFAOYSA-N |
| SMILES | C1CCN(CC1)C2=C(C=CC=N2)Br.Cl |
Computed by PubChem (NCBI)