cas: 16078-32-3 — see every product listed under this CAS number, including other names
1-(3,3-Dimethylindolin-1-yl)ethanone, 95-<97% (CAS 16078-32-3) is a chemical reagent available from Chemat. Available pack sizes: 500mg, 1g, 2,5g, 5g, 10g. Offered by: Hoffman Fine Chemicals.
| brand | Hoffman Fine Chemicals |
|---|---|
| catalog number | HFC5509-95-97-500mg |
| cas | 16078-32-3 |
| size | 500mg |
| availability | 3-4 tygodnie|3-4 weeks |
| brand | size | price | |
|---|---|---|---|
| Hoffman Fine Chemicals | 500mg | 3638.36 Pln | |
| Hoffman Fine Chemicals | 1g | 5431.14 Pln | |
| Hoffman Fine Chemicals | 2,5g | 9271.90 Pln | |
| Hoffman Fine Chemicals | 5g | 14650.24 Pln | |
| Hoffman Fine Chemicals | 10g | 24692.36 Pln |
| purity | 95-<97% |
|---|---|
| category | Chemicals |
| delivery time | 3-4 weeks |
1-(3,3-dimethyl-2H-indol-1-yl)ethanone (CAS 16078-32-3) is a chemical compound with the molecular formula C12H15NO and a molecular weight of 189.25 g/mol. IUPAC name: 1-(3,3-dimethyl-2H-indol-1-yl)ethanone. InChIKey: PYWPWPPRAYOLIB-UHFFFAOYSA-N.
| Molecular formula | C12H15NO |
|---|---|
| Molecular weight | 189.25 g/mol |
| IUPAC name | 1-(3,3-dimethyl-2H-indol-1-yl)ethanone |
| InChIKey | PYWPWPPRAYOLIB-UHFFFAOYSA-N |
| SMILES | CC(=O)N1CC(C2=CC=CC=C21)(C)C |
Computed by PubChem (NCBI)