CAS 1361386-54-0 is the registry number for 5-(tert-Butyl)isoindolin-1-one, 95%. Offered by: Combi-blocks. Available pack sizes: 250mg, 1g, 5g.
5-tert-butyl-2,3-dihydroisoindol-1-one (CAS 1361386-54-0) is a chemical compound with the molecular formula C12H15NO and a molecular weight of 189.25 g/mol. IUPAC name: 5-tert-butyl-2,3-dihydroisoindol-1-one. InChIKey: YMBHALKPLMZOAA-UHFFFAOYSA-N.
| Molecular formula | C12H15NO |
|---|---|
| Molecular weight | 189.25 g/mol |
| IUPAC name | 5-tert-butyl-2,3-dihydroisoindol-1-one |
| InChIKey | YMBHALKPLMZOAA-UHFFFAOYSA-N |
| SMILES | CC(C)(C)C1=CC2=C(C=C1)C(=O)NC2 |
Computed by PubChem (NCBI)