cas: 68120-72-9 — see every product listed under this CAS number, including other names
1-(3,4-Dichlorophenyl)pentan-1-one, 95% (CAS 68120-72-9) is a chemical reagent available from Chemat. Available pack sizes: 250mg, 1g, 5g, 10g. Offered by: Fluorochem.
| brand | Fluorochem |
|---|---|
| catalog number | F336989-250MG |
| cas | 68120-72-9 |
| size | 250mg |
| brand | size | price | |
|---|---|---|---|
| Fluorochem | 250mg | 138.51 Pln | |
| Fluorochem | 1g | 284.29 Pln | |
| Fluorochem | 5g | 893.45 Pln | |
| Fluorochem | 10g | 1643.19 Pln |
| purity | 95% |
|---|---|
| delivery time | 3-4 weeks |
1-(3,4-dichlorophenyl)pentan-1-one (CAS 68120-72-9) is a chemical compound with the molecular formula C11H12Cl2O and a molecular weight of 231.11 g/mol. IUPAC name: 1-(3,4-dichlorophenyl)pentan-1-one. InChIKey: DAQIQOIKLVJWKH-UHFFFAOYSA-N.
| Molecular formula | C11H12Cl2O |
|---|---|
| Molecular weight | 231.11 g/mol |
| IUPAC name | 1-(3,4-dichlorophenyl)pentan-1-one |
| InChIKey | DAQIQOIKLVJWKH-UHFFFAOYSA-N |
| SMILES | CCCCC(=O)C1=CC(=C(C=C1)Cl)Cl |
Computed by PubChem (NCBI)