CAS 1394980-60-9 is the registry number for 1,4-Dichloro-2-(cyclopentyloxy)benzene, 95%. Offered by: Combi-blocks. Available pack sizes: 1g, 5g.
1,4-dichloro-2-cyclopentyloxybenzene (CAS 1394980-60-9) is a chemical compound with the molecular formula C11H12Cl2O and a molecular weight of 231.11 g/mol. IUPAC name: 1,4-dichloro-2-cyclopentyloxybenzene. InChIKey: VFNSNXIXCOVXCZ-UHFFFAOYSA-N.
| Molecular formula | C11H12Cl2O |
|---|---|
| Molecular weight | 231.11 g/mol |
| IUPAC name | 1,4-dichloro-2-cyclopentyloxybenzene |
| InChIKey | VFNSNXIXCOVXCZ-UHFFFAOYSA-N |
| SMILES | C1CCC(C1)OC2=C(C=CC(=C2)Cl)Cl |
Computed by PubChem (NCBI)