cas: 2096997-21-4 — see every product listed under this CAS number, including other names
1-(3-(4,4,5,5-Tetramethyl-1,3,2-dioxaborolan-2-yl)benzyl)pyrrolidine-2,5-dione 95% (CAS 2096997-21-4) is a chemical reagent available from Chemat. Available pack sizes: 250mg, 1g, 5g, 25g. Offered by: Ambeed.
| brand | Ambeed |
|---|---|
| catalog number | A995916-250mg |
| cas | 2096997-21-4 |
| size | 250mg |
| brand | size | price | |
|---|---|---|---|
| Ambeed | 250mg | 281.38 Pln | |
| Ambeed | 1g | 620.69 Pln | |
| Ambeed | 5g | 1955.69 Pln | |
| Ambeed | 25g | 6989.75 Pln |
| purity | 95% |
|---|---|
| delivery time | 1-2 weeks |
| ambeed catalog no. | A995916 |
1-[[3-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)phenyl]methyl]pyrrolidine-2,5-dione (CAS 2096997-21-4) is a chemical compound with the molecular formula C17H22BNO4 and a molecular weight of 315.2 g/mol. IUPAC name: 1-[[3-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)phenyl]methyl]pyrrolidine-2,5-dione. InChIKey: LQVLWKHCUUWWLG-UHFFFAOYSA-N.
| Molecular formula | C17H22BNO4 |
|---|---|
| Molecular weight | 315.2 g/mol |
| IUPAC name | 1-[[3-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)phenyl]methyl]pyrrolidine-2,5-dione |
| InChIKey | LQVLWKHCUUWWLG-UHFFFAOYSA-N |
| SMILES | B1(OC(C(O1)(C)C)(C)C)C2=CC(=CC=C2)CN3C(=O)CCC3=O |
Computed by PubChem (NCBI)