cas: 939983-66-1 — see every product listed under this CAS number, including other names
1-(3-(Methylsulfonyl)propyl)piperazine dihydrochloride, 95%, 95% (CAS 939983-66-1) is a chemical reagent available from Chemat. Available pack sizes: 250mg, 1g, 5g, 10g, 25g. Offered by: Chemat.
| brand | Chemat |
|---|---|
| catalog number | Ch11GSOX-250mg |
| cas | 939983-66-1 |
| size | 250mg |
| availability | 325g |
| brand | size | price | |
|---|---|---|---|
| Chemat | 250mg | 98.00 Pln | |
| Chemat | 1g | 122.00 Pln | |
| Chemat | 5g | 338.00 Pln | |
| Chemat | 10g | 501.20 Pln | |
| Chemat | 25g | 1062.80 Pln |
| purity | 95% |
|---|---|
| delivery time | 3 weeks |
1-(3-methylsulfonylpropyl)piperazine;dihydrochloride (CAS 939983-66-1) is a chemical compound with the molecular formula C8H20Cl2N2O2S and a molecular weight of 279.23 g/mol. IUPAC name: 1-(3-methylsulfonylpropyl)piperazine;dihydrochloride. InChIKey: PJVIZDQFMOUMPU-UHFFFAOYSA-N.
| Molecular formula | C8H20Cl2N2O2S |
|---|---|
| Molecular weight | 279.23 g/mol |
| IUPAC name | 1-(3-methylsulfonylpropyl)piperazine;dihydrochloride |
| InChIKey | PJVIZDQFMOUMPU-UHFFFAOYSA-N |
| SMILES | CS(=O)(=O)CCCN1CCNCC1.Cl.Cl |
Computed by PubChem (NCBI)