cas: 939983-66-1 — see every product listed under this CAS number, including other names
1-(3-Methanesulfonylpropyl)piperazine dihydrochloride, 95% (CAS 939983-66-1) is a chemical reagent available from Chemat. Available pack sizes: 1g, 5g, 10g, 25g. Offered by: Fluorochem.
| brand | Fluorochem |
|---|---|
| catalog number | F078097-1G |
| cas | 939983-66-1 |
| size | 1g |
| brand | size | price | |
|---|---|---|---|
| Fluorochem | 1g | 190.58 Pln | |
| Fluorochem | 5g | 341.56 Pln | |
| Fluorochem | 10g | 622.72 Pln | |
| Fluorochem | 25g | 1195.43 Pln |
| purity | 95% |
|---|---|
| delivery time | 3-4 weeks |
1-(3-methylsulfonylpropyl)piperazine;dihydrochloride (CAS 939983-66-1) is a chemical compound with the molecular formula C8H20Cl2N2O2S and a molecular weight of 279.23 g/mol. IUPAC name: 1-(3-methylsulfonylpropyl)piperazine;dihydrochloride. InChIKey: PJVIZDQFMOUMPU-UHFFFAOYSA-N.
| Molecular formula | C8H20Cl2N2O2S |
|---|---|
| Molecular weight | 279.23 g/mol |
| IUPAC name | 1-(3-methylsulfonylpropyl)piperazine;dihydrochloride |
| InChIKey | PJVIZDQFMOUMPU-UHFFFAOYSA-N |
| SMILES | CS(=O)(=O)CCCN1CCNCC1.Cl.Cl |
Computed by PubChem (NCBI)