cas: 764667-65-4 — see every product listed under this CAS number, including other names
1-(3-(Trifluoromethyl)-5,6-dihydro-[1,2,4]triazolo[4,3-a]pyrazin-7(8H)-yl)-4-(2,4,5-trifluorophenyl)butane-1,3-dione, 98%, 98% (CAS 764667-65-4) is a chemical reagent available from Chemat. Available pack sizes: 1g, 5g, 10g, 25g, 100g. Offered by: Chemat.
| brand | Chemat |
|---|---|
| catalog number | Ch116LGP-1g |
| cas | 764667-65-4 |
| size | 1g |
| availability | 400g |
| brand | size | price | |
|---|---|---|---|
| Chemat | 1g | 74.00 Pln | |
| Chemat | 5g | 83.60 Pln | |
| Chemat | 10g | 102.80 Pln | |
| Chemat | 25g | 155.60 Pln | |
| Chemat | 100g | 405.20 Pln |
| purity | 98% |
|---|---|
| delivery time | 3 weeks |
1-[3-(trifluoromethyl)-6,8-dihydro-5H-[1,2,4]triazolo[4,3-a]pyrazin-7-yl]-4-(2,4,5-trifluorophenyl)butane-1,3-dione (CAS 764667-65-4) is a chemical compound with the molecular formula C16H12F6N4O2 and a molecular weight of 406.28 g/mol. IUPAC name: 1-[3-(trifluoromethyl)-6,8-dihydro-5H-[1,2,4]triazolo[4,3-a]pyrazin-7-yl]-4-(2,4,5-trifluorophenyl)butane-1,3-dione. InChIKey: QAEDTLFWHIEVPK-UHFFFAOYSA-N.
| Molecular formula | C16H12F6N4O2 |
|---|---|
| Molecular weight | 406.28 g/mol |
| IUPAC name | 1-[3-(trifluoromethyl)-6,8-dihydro-5H-[1,2,4]triazolo[4,3-a]pyrazin-7-yl]-4-(2,4,5-trifluorophenyl)butane-1,3-dione |
| InChIKey | QAEDTLFWHIEVPK-UHFFFAOYSA-N |
| SMILES | C1CN2C(=NN=C2C(F)(F)F)CN1C(=O)CC(=O)CC3=CC(=C(C=C3F)F)F |
Computed by PubChem (NCBI)